C37H33FNO+ — CID 164849822
2-[6-[4-[4-(1-deuteriocyclohexyl)phenyl]phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 164849822) has the molecular formula C37H33FNO+ and a molecular weight of 527.68 g/mol. Its IUPAC name is 2-[6-[4-[4-(1-deuteriocyclohexyl)phenyl]phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-[4-[4-(1-deuteriocyclohexyl)phenyl]phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 164849822 |
| Molecular Formula | C37H33FNO+ |
| Molecular Weight | 527.68 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 2-[6-[4-[4-(1-deuteriocyclohexyl)phenyl]phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [2H]C1(c2ccc(-c3ccc(-c4c(F)ccc5c4oc4c(-c6cccc[n+]6C)c(C)ccc45)cc3)cc2)CCCCC1 |
| InChI | InChI=1S/C37H33FNO/c1-24-11-20-30-31-21-22-32(38)35(37(31)40-36(30)34(24)33-10-6-7-23-39(33)2)29-18-16-28(17-19-29)27-14-12-26(13-15-27)25-8-4-3-5-9-25/h6-7,10-23,25H,3-5,8-9H2,1-2H3/q+1/i25D |
| InChIKey | QLIAMWNJXLNMBW-ZPJDWWTCSA-N |
| XLogP | 9.91 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.68 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|