C30H29FNO+ — CID 166038288
2-[6-[3-(2,2-dimethylpropyl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166038288) has the molecular formula C30H29FNO+ and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-[6-[3-(2,2-dimethylpropyl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-[3-(2,2-dimethylpropyl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166038288 |
| Molecular Formula | C30H29FNO+ |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 2-[6-[3-(2,2-dimethylpropyl)phenyl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4cccc(CC(C)(C)C)c4)c(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C30H29FNO/c1-19-12-13-22-23-14-15-24(31)27(21-10-8-9-20(17-21)18-30(2,3)4)29(23)33-28(22)26(19)25-11-6-7-16-32(25)5/h6-17H,18H2,1-5H3/q+1 |
| InChIKey | UCUXLNMBVPNSMV-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|