C39H37FNO+ — CID 164849327
2-[6-(9,9-dimethylfluoren-3-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-4-(2,2-dimethylpropyl)-1-methylpyridin-1-ium (PubChem CID 164849327) has the molecular formula C39H37FNO+ and a molecular weight of 554.73 g/mol. Its IUPAC name is 2-[6-(9,9-dimethylfluoren-3-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-4-(2,2-dimethylpropyl)-1-methylpyridin-1-ium.
| Compound Name | 2-[6-(9,9-dimethylfluoren-3-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-4-(2,2-dimethylpropyl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 164849327 |
| Molecular Formula | C39H37FNO+ |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | 2-[6-(9,9-dimethylfluoren-3-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-4-(2,2-dimethylpropyl)-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5c(c4)-c4ccccc4C5(C)C)c(F)ccc32)c1-c1cc(CC(C)(C)C)cc[n+]1C |
| InChI | InChI=1S/C39H37FNO/c1-23-12-14-27-28-15-17-32(40)35(25-13-16-31-29(21-25)26-10-8-9-11-30(26)39(31,5)6)37(28)42-36(27)34(23)33-20-24(18-19-41(33)7)22-38(2,3)4/h8-21H,22H2,1-7H3/q+1 |
| InChIKey | JIRIRFMCFVMMSV-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|