C38H34F2NO+ — CID 169282919
4-tert-butyl-2-[6-(9,9-dimethylfluoren-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-5-fluoro-1-methylpyridin-1-ium (PubChem CID 169282919) has the molecular formula C38H34F2NO+ and a molecular weight of 558.69 g/mol. Its IUPAC name is 4-tert-butyl-2-[6-(9,9-dimethylfluoren-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-5-fluoro-1-methylpyridin-1-ium.
| Compound Name | 4-tert-butyl-2-[6-(9,9-dimethylfluoren-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-5-fluoro-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 169282919 |
| Molecular Formula | C38H34F2NO+ |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | 4-tert-butyl-2-[6-(9,9-dimethylfluoren-2-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-5-fluoro-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)c(F)ccc32)c1-c1cc(C(C)(C)C)c(F)c[n+]1C |
| InChI | InChI=1S/C38H34F2NO/c1-21-12-14-25-26-16-17-30(39)34(22-13-15-24-23-10-8-9-11-27(23)38(5,6)28(24)18-22)36(26)42-35(25)33(21)32-19-29(37(2,3)4)31(40)20-41(32)7/h8-20H,1-7H3/q+1 |
| InChIKey | FKFJXRPBZGMYNV-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|