C36H30FN2O+ — CID 169282734
6-(4-tert-butyl-5-fluoro-1-methylpyridin-1-ium-2-yl)-7-methyl-4-(3-phenylphenyl)dibenzofuran-2-carbonitrile (PubChem CID 169282734) has the molecular formula C36H30FN2O+ and a molecular weight of 525.65 g/mol. Its IUPAC name is 6-(4-tert-butyl-5-fluoro-1-methylpyridin-1-ium-2-yl)-7-methyl-4-(3-phenylphenyl)dibenzofuran-2-carbonitrile.
| Compound Name | 6-(4-tert-butyl-5-fluoro-1-methylpyridin-1-ium-2-yl)-7-methyl-4-(3-phenylphenyl)dibenzofuran-2-carbonitrile |
|---|---|
| PubChem CID | 169282734 |
| Molecular Formula | C36H30FN2O+ |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 6-(4-tert-butyl-5-fluoro-1-methylpyridin-1-ium-2-yl)-7-methyl-4-(3-phenylphenyl)dibenzofuran-2-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(-c4cccc(-c5ccccc5)c4)cc(C#N)cc32)c1-c1cc(C(C)(C)C)c(F)c[n+]1C |
| InChI | InChI=1S/C36H30FN2O/c1-22-14-15-27-29-17-23(20-38)16-28(26-13-9-12-25(18-26)24-10-7-6-8-11-24)34(29)40-35(27)33(22)32-19-30(36(2,3)4)31(37)21-39(32)5/h6-19,21H,1-5H3/q+1 |
| InChIKey | AZRIFYMNTACGQH-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|