C41H36NO+ — CID 171723653
5-tert-butyl-1-methyl-2-(3-methyl-7-phenyldibenzofuran-4-yl)-4-(4-phenylphenyl)pyridin-1-ium (PubChem CID 171723653) has the molecular formula C41H36NO+ and a molecular weight of 558.75 g/mol. Its IUPAC name is 5-tert-butyl-1-methyl-2-(3-methyl-7-phenyldibenzofuran-4-yl)-4-(4-phenylphenyl)pyridin-1-ium.
| Compound Name | 5-tert-butyl-1-methyl-2-(3-methyl-7-phenyldibenzofuran-4-yl)-4-(4-phenylphenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 171723653 |
| Molecular Formula | C41H36NO+ |
| Molecular Weight | 558.75 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | 5-tert-butyl-1-methyl-2-(3-methyl-7-phenyldibenzofuran-4-yl)-4-(4-phenylphenyl)pyridin-1-ium |
| SMILES | Cc1ccc2c(oc3cc(-c4ccccc4)ccc32)c1-c1cc(-c2ccc(-c3ccccc3)cc2)c(C(C)(C)C)c[n+]1C |
| InChI | InChI=1S/C41H36NO/c1-27-16-22-34-33-23-21-32(29-14-10-7-11-15-29)24-38(33)43-40(34)39(27)37-25-35(36(26-42(37)5)41(2,3)4)31-19-17-30(18-20-31)28-12-8-6-9-13-28/h6-26H,1-5H3/q+1 |
| InChIKey | NDLKFXYDMXYOSS-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.75 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|