C44H42NO+ — CID 171723826
1-methyl-2-(3-methyl-7-phenyldibenzofuran-4-yl)-4-[4-phenyl-2,6-di(propan-2-yl)phenyl]-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 171723826) has the molecular formula C44H42NO+ and a molecular weight of 603.84 g/mol. Its IUPAC name is 1-methyl-2-(3-methyl-7-phenyldibenzofuran-4-yl)-4-[4-phenyl-2,6-di(propan-2-yl)phenyl]-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 1-methyl-2-(3-methyl-7-phenyldibenzofuran-4-yl)-4-[4-phenyl-2,6-di(propan-2-yl)phenyl]-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 171723826 |
| Molecular Formula | C44H42NO+ |
| Molecular Weight | 603.84 g/mol |
| Exact Mass | 603.34 |
| IUPAC Name | 1-methyl-2-(3-methyl-7-phenyldibenzofuran-4-yl)-4-[4-phenyl-2,6-di(propan-2-yl)phenyl]-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2c(C)ccc3c2oc2cc(-c4ccccc4)ccc23)cc1-c1c(C(C)C)cc(-c2ccccc2)cc1C(C)C |
| InChI | InChI=1S/C44H42NO/c1-27(2)37-22-34(32-16-12-9-13-17-32)23-38(28(3)4)43(37)39-25-40(45(7)26-30(39)6)42-29(5)18-20-36-35-21-19-33(24-41(35)46-44(36)42)31-14-10-8-11-15-31/h8-28H,1-7H3/q+1/i6D3 |
| InChIKey | SDDXHGSBEZMWIR-UNLAWSRZSA-N |
| XLogP | 11.94 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.84 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|