C37H35FNO+ — CID 171723976
4-[4-fluoro-2,6-di(propan-2-yl)phenyl]-1-methyl-2-(3-methyl-7-phenyldibenzofuran-4-yl)pyridin-1-ium (PubChem CID 171723976) has the molecular formula C37H35FNO+ and a molecular weight of 528.69 g/mol. Its IUPAC name is 4-[4-fluoro-2,6-di(propan-2-yl)phenyl]-1-methyl-2-(3-methyl-7-phenyldibenzofuran-4-yl)pyridin-1-ium.
| Compound Name | 4-[4-fluoro-2,6-di(propan-2-yl)phenyl]-1-methyl-2-(3-methyl-7-phenyldibenzofuran-4-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 171723976 |
| Molecular Formula | C37H35FNO+ |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 4-[4-fluoro-2,6-di(propan-2-yl)phenyl]-1-methyl-2-(3-methyl-7-phenyldibenzofuran-4-yl)pyridin-1-ium |
| SMILES | Cc1ccc2c(oc3cc(-c4ccccc4)ccc32)c1-c1cc(-c2c(C(C)C)cc(F)cc2C(C)C)cc[n+]1C |
| InChI | InChI=1S/C37H35FNO/c1-22(2)31-20-28(38)21-32(23(3)4)36(31)27-16-17-39(6)33(18-27)35-24(5)12-14-30-29-15-13-26(19-34(29)40-37(30)35)25-10-8-7-9-11-25/h7-23H,1-6H3/q+1 |
| InChIKey | OXSGZVLYMUIAHT-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|