C37H38NOSi+ — CID 171723727
trimethyl-[4-[4-[1-methyl-2-(3-methyldibenzofuran-4-yl)-5-(trideuteriomethyl)pyridin-1-ium-4-yl]-3,5-bis(trideuteriomethyl)phenyl]phenyl]silane (PubChem CID 171723727) has the molecular formula C37H38NOSi+ and a molecular weight of 549.86 g/mol. Its IUPAC name is trimethyl-[4-[4-[1-methyl-2-(3-methyldibenzofuran-4-yl)-5-(trideuteriomethyl)pyridin-1-ium-4-yl]-3,5-bis(trideuteriomethyl)phenyl]phenyl]silane.
| Compound Name | trimethyl-[4-[4-[1-methyl-2-(3-methyldibenzofuran-4-yl)-5-(trideuteriomethyl)pyridin-1-ium-4-yl]-3,5-bis(trideuteriomethyl)phenyl]phenyl]silane |
|---|---|
| PubChem CID | 171723727 |
| Molecular Formula | C37H38NOSi+ |
| Molecular Weight | 549.86 g/mol |
| Exact Mass | 549.33 |
| IUPAC Name | trimethyl-[4-[4-[1-methyl-2-(3-methyldibenzofuran-4-yl)-5-(trideuteriomethyl)pyridin-1-ium-4-yl]-3,5-bis(trideuteriomethyl)phenyl]phenyl]silane |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2c(C)ccc3c2oc2ccccc23)cc1-c1c(C([2H])([2H])[2H])cc(-c2ccc([Si](C)(C)C)cc2)cc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C37H38NOSi/c1-23-13-18-31-30-11-9-10-12-34(30)39-37(31)36(23)33-21-32(26(4)22-38(33)5)35-24(2)19-28(20-25(35)3)27-14-16-29(17-15-27)40(6,7)8/h9-22H,1-8H3/q+1/i2D3,3D3,4D3 |
| InChIKey | IFUABAHVFIQIMJ-WVZRYRIDSA-N |
| XLogP | 9.19 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.86 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|