C31H30NO2+ — CID 153418225
4-(1,1-dideuterio-2,2-dimethylpropyl)-1-methyl-2-(7-methyl-10,20-dioxapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14,16,18-nonaen-8-yl)-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 153418225) has the molecular formula C31H30NO2+ and a molecular weight of 453.62 g/mol. Its IUPAC name is 4-(1,1-dideuterio-2,2-dimethylpropyl)-1-methyl-2-(7-methyl-10,20-dioxapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14,16,18-nonaen-8-yl)-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 4-(1,1-dideuterio-2,2-dimethylpropyl)-1-methyl-2-(7-methyl-10,20-dioxapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14,16,18-nonaen-8-yl)-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 153418225 |
| Molecular Formula | C31H30NO2+ |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 4-(1,1-dideuterio-2,2-dimethylpropyl)-1-methyl-2-(7-methyl-10,20-dioxapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14,16,18-nonaen-8-yl)-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2c(C)ccc3c2oc2cc4c(cc23)oc2ccccc24)cc1C([2H])([2H])C(C)(C)C |
| InChI | InChI=1S/C31H30NO2/c1-18-11-12-22-24-15-27-23(21-9-7-8-10-26(21)33-27)14-28(24)34-30(22)29(18)25-13-20(16-31(3,4)5)19(2)17-32(25)6/h7-15,17H,16H2,1-6H3/q+1/i2D3,16D2 |
| InChIKey | IXALZFXROQJOTP-HEOWRTSXSA-N |
| XLogP | 8.18 |
| TPSA | 30.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|