C33H42NO+ — CID 176822868
4-(1,1-dideuterio-2,2-dimethylpropyl)-1-methyl-2-(1,1,4,4,5-pentamethyl-2,3-dihydronaphtho[2,1-b][1]benzofuran-6-yl)-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 176822868) has the molecular formula C33H42NO+ and a molecular weight of 473.74 g/mol. Its IUPAC name is 4-(1,1-dideuterio-2,2-dimethylpropyl)-1-methyl-2-(1,1,4,4,5-pentamethyl-2,3-dihydronaphtho[2,1-b][1]benzofuran-6-yl)-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 4-(1,1-dideuterio-2,2-dimethylpropyl)-1-methyl-2-(1,1,4,4,5-pentamethyl-2,3-dihydronaphtho[2,1-b][1]benzofuran-6-yl)-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 176822868 |
| Molecular Formula | C33H42NO+ |
| Molecular Weight | 473.74 g/mol |
| Exact Mass | 473.36 |
| IUPAC Name | 4-(1,1-dideuterio-2,2-dimethylpropyl)-1-methyl-2-(1,1,4,4,5-pentamethyl-2,3-dihydronaphtho[2,1-b][1]benzofuran-6-yl)-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2c(C)c3c(c4c2oc2ccccc24)C(C)(C)CCC3(C)C)cc1C([2H])([2H])C(C)(C)C |
| InChI | InChI=1S/C33H42NO/c1-20-19-34(10)24(17-22(20)18-31(3,4)5)26-21(2)28-29(33(8,9)16-15-32(28,6)7)27-23-13-11-12-14-25(23)35-30(26)27/h11-14,17,19H,15-16,18H2,1-10H3/q+1/i1D3,18D2 |
| InChIKey | HAWGXMCZCGREAC-GAJUIYLVSA-N |
| XLogP | 8.63 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.74 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|