C30H37N2O+ — CID 176822715
9-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-3,3,6,6,8-pentamethyl-11-oxa-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaene (PubChem CID 176822715) has the molecular formula C30H37N2O+ and a molecular weight of 441.64 g/mol. Its IUPAC name is 9-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-3,3,6,6,8-pentamethyl-11-oxa-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaene.
| Compound Name | 9-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-3,3,6,6,8-pentamethyl-11-oxa-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaene |
|---|---|
| PubChem CID | 176822715 |
| Molecular Formula | C30H37N2O+ |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | 9-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-3,3,6,6,8-pentamethyl-11-oxa-13-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaene |
| SMILES | Cc1c2c(c3c(oc4ncccc43)c1-c1cc(C(C)(C)C)cc[n+]1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C30H37N2O/c1-18-22(21-17-19(28(2,3)4)12-16-32(21)9)26-23(20-11-10-15-31-27(20)33-26)25-24(18)29(5,6)13-14-30(25,7)8/h10-12,15-17H,13-14H2,1-9H3/q+1 |
| InChIKey | RIFOZWDZOCIKBH-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|