C27H31N2O+ — CID 176823009
2-(1,1,4,4,7,9-hexamethyl-2,3-dihydronaphtho[1,2-b][1]benzofuran-10-yl)-1-methylpyrazin-1-ium (PubChem CID 176823009) has the molecular formula C27H31N2O+ and a molecular weight of 399.56 g/mol. Its IUPAC name is 2-(1,1,4,4,7,9-hexamethyl-2,3-dihydronaphtho[1,2-b][1]benzofuran-10-yl)-1-methylpyrazin-1-ium.
| Compound Name | 2-(1,1,4,4,7,9-hexamethyl-2,3-dihydronaphtho[1,2-b][1]benzofuran-10-yl)-1-methylpyrazin-1-ium |
|---|---|
| PubChem CID | 176823009 |
| Molecular Formula | C27H31N2O+ |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 2-(1,1,4,4,7,9-hexamethyl-2,3-dihydronaphtho[1,2-b][1]benzofuran-10-yl)-1-methylpyrazin-1-ium |
| SMILES | Cc1cc(C)c2c(oc3c4c(ccc32)C(C)(C)CCC4(C)C)c1-c1cncc[n+]1C |
| InChI | InChI=1S/C27H31N2O/c1-16-14-17(2)22(20-15-28-12-13-29(20)7)25-21(16)18-8-9-19-23(24(18)30-25)27(5,6)11-10-26(19,3)4/h8-9,12-15H,10-11H2,1-7H3/q+1 |
| InChIKey | HKOWFBDJMDFVLZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|