C35H40NO+ — CID 176822408
1-(1,1,4,4,7,9-hexamethyl-2,3-dihydronaphtho[1,2-b][1]benzofuran-10-yl)-2-methyl-6-propan-2-ylisoquinolin-2-ium (PubChem CID 176822408) has the molecular formula C35H40NO+ and a molecular weight of 490.71 g/mol. Its IUPAC name is 1-(1,1,4,4,7,9-hexamethyl-2,3-dihydronaphtho[1,2-b][1]benzofuran-10-yl)-2-methyl-6-propan-2-ylisoquinolin-2-ium.
| Compound Name | 1-(1,1,4,4,7,9-hexamethyl-2,3-dihydronaphtho[1,2-b][1]benzofuran-10-yl)-2-methyl-6-propan-2-ylisoquinolin-2-ium |
|---|---|
| PubChem CID | 176822408 |
| Molecular Formula | C35H40NO+ |
| Molecular Weight | 490.71 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 1-(1,1,4,4,7,9-hexamethyl-2,3-dihydronaphtho[1,2-b][1]benzofuran-10-yl)-2-methyl-6-propan-2-ylisoquinolin-2-ium |
| SMILES | Cc1cc(C)c2c(oc3c4c(ccc32)C(C)(C)CCC4(C)C)c1-c1c2ccc(C(C)C)cc2cc[n+]1C |
| InChI | InChI=1S/C35H40NO/c1-20(2)23-10-11-25-24(19-23)14-17-36(9)31(25)29-22(4)18-21(3)28-26-12-13-27-30(32(26)37-33(28)29)35(7,8)16-15-34(27,5)6/h10-14,17-20H,15-16H2,1-9H3/q+1 |
| InChIKey | HGWFGNQEQVOLFK-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.71 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|