C39H46NO+ — CID 176822368
2,5,5,8,8-pentamethyl-1-(3,3,6,6,18-pentamethyl-21-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),8,10,12,15(20),16,18-octaen-19-yl)-6,7-dihydroisoquinolin-2-ium (PubChem CID 176822368) has the molecular formula C39H46NO+ and a molecular weight of 544.80 g/mol. Its IUPAC name is 2,5,5,8,8-pentamethyl-1-(3,3,6,6,18-pentamethyl-21-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),8,10,12,15(20),16,18-octaen-19-yl)-6,7-dihydroisoquinolin-2-ium.
| Compound Name | 2,5,5,8,8-pentamethyl-1-(3,3,6,6,18-pentamethyl-21-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),8,10,12,15(20),16,18-octaen-19-yl)-6,7-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 176822368 |
| Molecular Formula | C39H46NO+ |
| Molecular Weight | 544.80 g/mol |
| Exact Mass | 544.36 |
| IUPAC Name | 2,5,5,8,8-pentamethyl-1-(3,3,6,6,18-pentamethyl-21-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),8,10,12,15(20),16,18-octaen-19-yl)-6,7-dihydroisoquinolin-2-ium |
| SMILES | Cc1ccc2c(oc3c4c(c5ccccc5c32)C(C)(C)CCC4(C)C)c1-c1c2c(cc[n+]1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C39H46NO/c1-23-15-16-26-29-24-13-11-12-14-25(24)30-32(39(8,9)21-20-37(30,4)5)35(29)41-34(26)28(23)33-31-27(17-22-40(33)10)36(2,3)18-19-38(31,6)7/h11-17,22H,18-21H2,1-10H3/q+1 |
| InChIKey | MFKUQLYFZQNZPD-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.80 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|