C30H31N2O+ — CID 176822477
9-methyl-10-(2,5,5,8,8-pentamethyl-6,7-dihydroisoquinolin-2-ium-1-yl)-[1]benzofuro[3,2-c]quinoline (PubChem CID 176822477) has the molecular formula C30H31N2O+ and a molecular weight of 435.59 g/mol. Its IUPAC name is 9-methyl-10-(2,5,5,8,8-pentamethyl-6,7-dihydroisoquinolin-2-ium-1-yl)-[1]benzofuro[3,2-c]quinoline.
| Compound Name | 9-methyl-10-(2,5,5,8,8-pentamethyl-6,7-dihydroisoquinolin-2-ium-1-yl)-[1]benzofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 176822477 |
| Molecular Formula | C30H31N2O+ |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 9-methyl-10-(2,5,5,8,8-pentamethyl-6,7-dihydroisoquinolin-2-ium-1-yl)-[1]benzofuro[3,2-c]quinoline |
| SMILES | Cc1ccc2c(oc3c4ccccc4ncc23)c1-c1c2c(cc[n+]1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C30H31N2O/c1-18-11-12-19-21-17-31-23-10-8-7-9-20(23)27(21)33-28(19)24(18)26-25-22(13-16-32(26)6)29(2,3)14-15-30(25,4)5/h7-13,16-17H,14-15H2,1-6H3/q+1 |
| InChIKey | BSNGFNCRDACPLM-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|