C31H33N2O+ — CID 176822832
2,5,5,8,8-pentamethyl-1-(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)-4-(trideuteriomethyl)-6,7-dihydrophthalazin-2-ium (PubChem CID 176822832) has the molecular formula C31H33N2O+ and a molecular weight of 452.64 g/mol. Its IUPAC name is 2,5,5,8,8-pentamethyl-1-(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)-4-(trideuteriomethyl)-6,7-dihydrophthalazin-2-ium.
| Compound Name | 2,5,5,8,8-pentamethyl-1-(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)-4-(trideuteriomethyl)-6,7-dihydrophthalazin-2-ium |
|---|---|
| PubChem CID | 176822832 |
| Molecular Formula | C31H33N2O+ |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 2,5,5,8,8-pentamethyl-1-(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)-4-(trideuteriomethyl)-6,7-dihydrophthalazin-2-ium |
| SMILES | [2H]C([2H])([2H])c1n[n+](C)c(-c2c(C)ccc3c2oc2c4ccccc4ccc32)c2c1C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C31H33N2O/c1-18-12-14-23-22-15-13-20-10-8-9-11-21(20)28(22)34-29(23)24(18)27-26-25(19(2)32-33(27)7)30(3,4)16-17-31(26,5)6/h8-15H,16-17H2,1-7H3/q+1/i2D3 |
| InChIKey | QACOFAMPAMAYDE-BMSJAHLVSA-N |
| XLogP | 7.59 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|