C37H36NO+ — CID 166044129
4-[4-(1-deuterio-4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)pyridin-1-ium (PubChem CID 166044129) has the molecular formula C37H36NO+ and a molecular weight of 511.71 g/mol. Its IUPAC name is 4-[4-(1-deuterio-4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)pyridin-1-ium.
| Compound Name | 4-[4-(1-deuterio-4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 166044129 |
| Molecular Formula | C37H36NO+ |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | 4-[4-(1-deuterio-4,4-dimethylcyclohexyl)phenyl]-1-methyl-2-(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)pyridin-1-ium |
| SMILES | [2H]C1(c2ccc(-c3cc[n+](C)c(-c4c(C)ccc5c4oc4c6ccccc6ccc54)c3)cc2)CCC(C)(C)CC1 |
| InChI | InChI=1S/C37H36NO/c1-24-9-15-32-31-16-14-28-7-5-6-8-30(28)35(31)39-36(32)34(24)33-23-29(19-22-38(33)4)26-12-10-25(11-13-26)27-17-20-37(2,3)21-18-27/h5-16,19,22-23,27H,17-18,20-21H2,1-4H3/q+1/i27D |
| InChIKey | SEBOXXGCQQHNOT-BPVCDHNKSA-N |
| XLogP | 9.89 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|