C29H30N3O+ — CID 176822430
3-methyl-4-(3,5,5,8,8-pentamethyl-6,7-dihydroquinazolin-3-ium-4-yl)-[1]benzofuro[2,3-b]quinoline (PubChem CID 176822430) has the molecular formula C29H30N3O+ and a molecular weight of 436.58 g/mol. Its IUPAC name is 3-methyl-4-(3,5,5,8,8-pentamethyl-6,7-dihydroquinazolin-3-ium-4-yl)-[1]benzofuro[2,3-b]quinoline.
| Compound Name | 3-methyl-4-(3,5,5,8,8-pentamethyl-6,7-dihydroquinazolin-3-ium-4-yl)-[1]benzofuro[2,3-b]quinoline |
|---|---|
| PubChem CID | 176822430 |
| Molecular Formula | C29H30N3O+ |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 3-methyl-4-(3,5,5,8,8-pentamethyl-6,7-dihydroquinazolin-3-ium-4-yl)-[1]benzofuro[2,3-b]quinoline |
| SMILES | Cc1ccc2c(oc3nc4ccccc4cc32)c1-c1c2c(nc[n+]1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C29H30N3O/c1-17-11-12-19-20-15-18-9-7-8-10-21(18)31-27(20)33-25(19)22(17)24-23-26(30-16-32(24)6)29(4,5)14-13-28(23,2)3/h7-12,15-16H,13-14H2,1-6H3/q+1 |
| InChIKey | HNPXXNJBSCJFEC-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 42.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|