C21H14F2N3O+ — CID 153464413
2,4-difluoro-7-methyl-8-(3-methylquinazolin-3-ium-4-yl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 153464413) has the molecular formula C21H14F2N3O+ and a molecular weight of 362.36 g/mol. Its IUPAC name is 2,4-difluoro-7-methyl-8-(3-methylquinazolin-3-ium-4-yl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2,4-difluoro-7-methyl-8-(3-methylquinazolin-3-ium-4-yl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 153464413 |
| Molecular Formula | C21H14F2N3O+ |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2,4-difluoro-7-methyl-8-(3-methylquinazolin-3-ium-4-yl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(oc3nc(F)cc(F)c32)c1-c1c2ccccc2nc[n+]1C |
| InChI | InChI=1S/C21H14F2N3O/c1-11-7-8-13-18-14(22)9-16(23)25-21(18)27-20(13)17(11)19-12-5-3-4-6-15(12)24-10-26(19)2/h3-10H,1-2H3/q+1 |
| InChIKey | GIFNRWZEYJRUCQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 42.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|