C26H24FN2O+ — CID 153464799
8-(1,4-dimethyl-5-propan-2-ylpyridin-1-ium-2-yl)-5-fluoro-9-methyl-[1]benzofuro[2,3-c]isoquinoline (PubChem CID 153464799) has the molecular formula C26H24FN2O+ and a molecular weight of 399.49 g/mol. Its IUPAC name is 8-(1,4-dimethyl-5-propan-2-ylpyridin-1-ium-2-yl)-5-fluoro-9-methyl-[1]benzofuro[2,3-c]isoquinoline.
| Compound Name | 8-(1,4-dimethyl-5-propan-2-ylpyridin-1-ium-2-yl)-5-fluoro-9-methyl-[1]benzofuro[2,3-c]isoquinoline |
|---|---|
| PubChem CID | 153464799 |
| Molecular Formula | C26H24FN2O+ |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 8-(1,4-dimethyl-5-propan-2-ylpyridin-1-ium-2-yl)-5-fluoro-9-methyl-[1]benzofuro[2,3-c]isoquinoline |
| SMILES | Cc1cc(-c2c(C)ccc3c2oc2nc(F)c4ccccc4c23)[n+](C)cc1C(C)C |
| InChI | InChI=1S/C26H24FN2O/c1-14(2)20-13-29(5)21(12-16(20)4)22-15(3)10-11-19-23-17-8-6-7-9-18(17)25(27)28-26(23)30-24(19)22/h6-14H,1-5H3/q+1 |
| InChIKey | YVDHRVANNNWHPN-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|