C26H31N2O+ — CID 167357555
2-tert-butyl-8-(1,4-dimethyl-5-propan-2-ylpyridin-1-ium-2-yl)-7-methyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 167357555) has the molecular formula C26H31N2O+ and a molecular weight of 387.55 g/mol. Its IUPAC name is 2-tert-butyl-8-(1,4-dimethyl-5-propan-2-ylpyridin-1-ium-2-yl)-7-methyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2-tert-butyl-8-(1,4-dimethyl-5-propan-2-ylpyridin-1-ium-2-yl)-7-methyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 167357555 |
| Molecular Formula | C26H31N2O+ |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 2-tert-butyl-8-(1,4-dimethyl-5-propan-2-ylpyridin-1-ium-2-yl)-7-methyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1cc(-c2c(C)ccc3c2oc2nc(C(C)(C)C)ccc23)[n+](C)cc1C(C)C |
| InChI | InChI=1S/C26H31N2O/c1-15(2)20-14-28(8)21(13-17(20)4)23-16(3)9-10-18-19-11-12-22(26(5,6)7)27-25(19)29-24(18)23/h9-15H,1-8H3/q+1 |
| InChIKey | HFOBHUBXUKNQME-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|