C31H33N2O+ — CID 157252382
2-(1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-yl)-7-methyl-8-[1-methyl-4-(4-propan-2-ylphenyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 157252382) has the molecular formula C31H33N2O+ and a molecular weight of 455.65 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-yl)-7-methyl-8-[1-methyl-4-(4-propan-2-ylphenyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2-(1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-yl)-7-methyl-8-[1-methyl-4-(4-propan-2-ylphenyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 157252382 |
| Molecular Formula | C31H33N2O+ |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-yl)-7-methyl-8-[1-methyl-4-(4-propan-2-ylphenyl)pyridin-1-ium-2-yl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | [2H]C([2H])([2H])C(C)(c1ccc2c(n1)oc1c(-c3cc(-c4ccc(C(C)C)cc4)cc[n+]3C)c(C)ccc12)C([2H])([2H])[2H] |
| InChI | InChI=1S/C31H33N2O/c1-19(2)21-9-11-22(12-10-21)23-16-17-33(7)26(18-23)28-20(3)8-13-24-25-14-15-27(31(4,5)6)32-30(25)34-29(24)28/h8-19H,1-7H3/q+1/i4D3,5D3 |
| InChIKey | IOJRQHUCMXQNHD-RKAHMFOGSA-N |
| XLogP | 7.87 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|