C22H23N2O+ — CID 123840302
8-(1,4-dimethylpyridin-1-ium-2-yl)-7-methyl-3-propan-2-yl-[1]benzofuro[2,3-b]pyridine (PubChem CID 123840302) has the molecular formula C22H23N2O+ and a molecular weight of 331.44 g/mol. Its IUPAC name is 8-(1,4-dimethylpyridin-1-ium-2-yl)-7-methyl-3-propan-2-yl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 8-(1,4-dimethylpyridin-1-ium-2-yl)-7-methyl-3-propan-2-yl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 123840302 |
| Molecular Formula | C22H23N2O+ |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 8-(1,4-dimethylpyridin-1-ium-2-yl)-7-methyl-3-propan-2-yl-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1cc[n+](C)c(-c2c(C)ccc3c2oc2ncc(C(C)C)cc23)c1 |
| InChI | InChI=1S/C22H23N2O/c1-13(2)16-11-18-17-7-6-15(4)20(21(17)25-22(18)23-12-16)19-10-14(3)8-9-24(19)5/h6-13H,1-5H3/q+1 |
| InChIKey | VWICPAUVKMFFKU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|