C28H25N2O+ — CID 155648898
5-(1,4-dimethylpyridin-1-ium-2-yl)-6,20,20-trimethyl-3-oxa-18-azapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14(19),15,17-nonaene (PubChem CID 155648898) has the molecular formula C28H25N2O+ and a molecular weight of 405.52 g/mol. Its IUPAC name is 5-(1,4-dimethylpyridin-1-ium-2-yl)-6,20,20-trimethyl-3-oxa-18-azapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14(19),15,17-nonaene.
| Compound Name | 5-(1,4-dimethylpyridin-1-ium-2-yl)-6,20,20-trimethyl-3-oxa-18-azapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14(19),15,17-nonaene |
|---|---|
| PubChem CID | 155648898 |
| Molecular Formula | C28H25N2O+ |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 5-(1,4-dimethylpyridin-1-ium-2-yl)-6,20,20-trimethyl-3-oxa-18-azapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14(19),15,17-nonaene |
| SMILES | Cc1cc[n+](C)c(-c2c(C)ccc3c2oc2c4c(ccc23)-c2cccnc2C4(C)C)c1 |
| InChI | InChI=1S/C28H25N2O/c1-16-12-14-30(5)22(15-16)23-17(2)8-9-19-20-11-10-18-21-7-6-13-29-27(21)28(3,4)24(18)26(20)31-25(19)23/h6-15H,1-5H3/q+1 |
| InChIKey | GMCARJSGKAWDFJ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|