C26H22N3O+ — CID 155648919
6,20,20-trimethyl-5-(1-methylpyridin-1-ium-2-yl)-3-oxa-11,18-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1,4(9),5,7,10,12,14(19),15,17-nonaene (PubChem CID 155648919) has the molecular formula C26H22N3O+ and a molecular weight of 392.48 g/mol. Its IUPAC name is 6,20,20-trimethyl-5-(1-methylpyridin-1-ium-2-yl)-3-oxa-11,18-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1,4(9),5,7,10,12,14(19),15,17-nonaene.
| Compound Name | 6,20,20-trimethyl-5-(1-methylpyridin-1-ium-2-yl)-3-oxa-11,18-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1,4(9),5,7,10,12,14(19),15,17-nonaene |
|---|---|
| PubChem CID | 155648919 |
| Molecular Formula | C26H22N3O+ |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 6,20,20-trimethyl-5-(1-methylpyridin-1-ium-2-yl)-3-oxa-11,18-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1,4(9),5,7,10,12,14(19),15,17-nonaene |
| SMILES | Cc1ccc2c(oc3c4c(cnc32)-c2cccnc2C4(C)C)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C26H22N3O/c1-15-10-11-17-22-24(30-23(17)20(15)19-9-5-6-13-29(19)4)21-18(14-28-22)16-8-7-12-27-25(16)26(21,2)3/h5-14H,1-4H3/q+1 |
| InChIKey | SGGMJVKQJFACOM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 42.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|