C34H25N4O+ — CID 176787862
2-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 176787862) has the molecular formula C34H25N4O+ and a molecular weight of 505.60 g/mol. Its IUPAC name is 2-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 176787862 |
| Molecular Formula | C34H25N4O+ |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 2-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1ccc2c(oc3c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C34H25N4O/c1-22-19-20-26-25-16-11-17-27(30(25)39-31(26)29(22)28-18-9-10-21-38(28)2)34-36-32(23-12-5-3-6-13-23)35-33(37-34)24-14-7-4-8-15-24/h3-21H,1-2H3/q+1 |
| InChIKey | SNWOGODABSDZNB-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 55.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|