C29H28NOSi+ — CID 166051592
1-methyl-2-[3-methyl-6-(1,1,3,3-tetradeuterio-2,2-dimethyl-2-benzosilol-4-yl)dibenzofuran-4-yl]pyridin-1-ium (PubChem CID 166051592) has the molecular formula C29H28NOSi+ and a molecular weight of 438.66 g/mol. Its IUPAC name is 1-methyl-2-[3-methyl-6-(1,1,3,3-tetradeuterio-2,2-dimethyl-2-benzosilol-4-yl)dibenzofuran-4-yl]pyridin-1-ium.
| Compound Name | 1-methyl-2-[3-methyl-6-(1,1,3,3-tetradeuterio-2,2-dimethyl-2-benzosilol-4-yl)dibenzofuran-4-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 166051592 |
| Molecular Formula | C29H28NOSi+ |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 1-methyl-2-[3-methyl-6-(1,1,3,3-tetradeuterio-2,2-dimethyl-2-benzosilol-4-yl)dibenzofuran-4-yl]pyridin-1-ium |
| SMILES | [2H]C1([2H])c2cccc(-c3cccc4c3oc3c(-c5cccc[n+]5C)c(C)ccc34)c2C([2H])([2H])[Si]1(C)C |
| InChI | InChI=1S/C29H28NOSi/c1-19-14-15-24-23-12-8-11-22(21-10-7-9-20-17-32(3,4)18-25(20)21)28(23)31-29(24)27(19)26-13-5-6-16-30(26)2/h5-16H,17-18H2,1-4H3/q+1/i17D2,18D2 |
| InChIKey | DPZWTLGQUDJQPW-DBTGQBASSA-N |
| XLogP | 6.94 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|