C29H26NO+ — CID 166051543
1-methyl-2-[3-methyl-6-(6-methyl-2,3-dihydro-1H-inden-4-yl)dibenzofuran-4-yl]pyridin-1-ium (PubChem CID 166051543) has the molecular formula C29H26NO+ and a molecular weight of 404.53 g/mol. Its IUPAC name is 1-methyl-2-[3-methyl-6-(6-methyl-2,3-dihydro-1H-inden-4-yl)dibenzofuran-4-yl]pyridin-1-ium.
| Compound Name | 1-methyl-2-[3-methyl-6-(6-methyl-2,3-dihydro-1H-inden-4-yl)dibenzofuran-4-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 166051543 |
| Molecular Formula | C29H26NO+ |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-methyl-2-[3-methyl-6-(6-methyl-2,3-dihydro-1H-inden-4-yl)dibenzofuran-4-yl]pyridin-1-ium |
| SMILES | Cc1cc2c(c(-c3cccc4c3oc3c(-c5cccc[n+]5C)c(C)ccc34)c1)CCC2 |
| InChI | InChI=1S/C29H26NO/c1-18-16-20-8-6-9-21(20)25(17-18)23-11-7-10-22-24-14-13-19(2)27(29(24)31-28(22)23)26-12-4-5-15-30(26)3/h4-5,7,10-17H,6,8-9H2,1-3H3/q+1 |
| InChIKey | WHRBOWMQZFNKST-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|