C33H24NO+ — CID 169077087
2-[6-(10-deuterioanthracen-9-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 169077087) has the molecular formula C33H24NO+ and a molecular weight of 451.57 g/mol. Its IUPAC name is 2-[6-(10-deuterioanthracen-9-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-(10-deuterioanthracen-9-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 169077087 |
| Molecular Formula | C33H24NO+ |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 2-[6-(10-deuterioanthracen-9-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [2H]c1c2ccccc2c(-c2cccc3c2oc2c(-c4cccc[n+]4C)c(C)ccc23)c2ccccc12 |
| InChI | InChI=1S/C33H24NO/c1-21-17-18-27-26-14-9-15-28(32(26)35-33(27)30(21)29-16-7-8-19-34(29)2)31-24-12-5-3-10-22(24)20-23-11-4-6-13-25(23)31/h3-20H,1-2H3/q+1/i20D |
| InChIKey | JQIPTCUXGTZBFZ-YVHRXSIGSA-N |
| XLogP | 8.36 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|