C26H22NO+ — CID 167357356
2-(3,8-dimethyl-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium (PubChem CID 167357356) has the molecular formula C26H22NO+ and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-(3,8-dimethyl-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium.
| Compound Name | 2-(3,8-dimethyl-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 167357356 |
| Molecular Formula | C26H22NO+ |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 2-(3,8-dimethyl-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
| SMILES | Cc1cc(-c2ccccc2)c2oc3c(-c4cccc[n+]4C)c(C)ccc3c2c1 |
| InChI | InChI=1S/C26H22NO/c1-17-15-21(19-9-5-4-6-10-19)25-22(16-17)20-13-12-18(2)24(26(20)28-25)23-11-7-8-14-27(23)3/h4-16H,1-3H3/q+1 |
| InChIKey | ASNUIFYYFOCCQB-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|