C28H24NOSe+ — CID 166051510
2-[6-(4,4-dideuterio-2,3-dihydroselenochromen-8-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166051510) has the molecular formula C28H24NOSe+ and a molecular weight of 471.48 g/mol. Its IUPAC name is 2-[6-(4,4-dideuterio-2,3-dihydroselenochromen-8-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-(4,4-dideuterio-2,3-dihydroselenochromen-8-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166051510 |
| Molecular Formula | C28H24NOSe+ |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 2-[6-(4,4-dideuterio-2,3-dihydroselenochromen-8-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [2H]C1([2H])CC[Se]c2c(-c3cccc4c3oc3c(-c5cccc[n+]5C)c(C)ccc34)cccc21 |
| InChI | InChI=1S/C28H24NOSe/c1-18-14-15-22-20-10-6-11-21(23-12-5-8-19-9-7-17-31-28(19)23)26(20)30-27(22)25(18)24-13-3-4-16-29(24)2/h3-6,8,10-16H,7,9,17H2,1-2H3/q+1/i9D2 |
| InChIKey | ABUBTCXWTCUOFF-KNXIQCGSSA-N |
| XLogP | 5.75 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|