C34H29N2O+ — CID 166051936
4,4-dideuterio-8-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-1-phenyl-2,3-dihydroquinoline (PubChem CID 166051936) has the molecular formula C34H29N2O+ and a molecular weight of 483.63 g/mol. Its IUPAC name is 4,4-dideuterio-8-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-1-phenyl-2,3-dihydroquinoline.
| Compound Name | 4,4-dideuterio-8-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-1-phenyl-2,3-dihydroquinoline |
|---|---|
| PubChem CID | 166051936 |
| Molecular Formula | C34H29N2O+ |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 4,4-dideuterio-8-[7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-1-phenyl-2,3-dihydroquinoline |
| SMILES | [2H]C1([2H])CCN(c2ccccc2)c2c(-c3cccc4c3oc3c(-c5cccc[n+]5C)c(C)ccc34)cccc21 |
| InChI | InChI=1S/C34H29N2O/c1-23-19-20-29-28-17-9-16-27(33(28)37-34(29)31(23)30-18-6-7-21-35(30)2)26-15-8-11-24-12-10-22-36(32(24)26)25-13-4-3-5-14-25/h3-9,11,13-21H,10,12,22H2,1-2H3/q+1/i12D2 |
| InChIKey | HBBLQKVBKTXVKZ-XUWBISKJSA-N |
| XLogP | 8.14 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|