C30H30NO+ — CID 166051839
1-methyl-2-[3-methyl-6-(4,4,7,7-tetradeuterio-3,3-dimethyl-5,6-dihydroinden-1-yl)dibenzofuran-4-yl]pyridin-1-ium (PubChem CID 166051839) has the molecular formula C30H30NO+ and a molecular weight of 424.60 g/mol. Its IUPAC name is 1-methyl-2-[3-methyl-6-(4,4,7,7-tetradeuterio-3,3-dimethyl-5,6-dihydroinden-1-yl)dibenzofuran-4-yl]pyridin-1-ium.
| Compound Name | 1-methyl-2-[3-methyl-6-(4,4,7,7-tetradeuterio-3,3-dimethyl-5,6-dihydroinden-1-yl)dibenzofuran-4-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 166051839 |
| Molecular Formula | C30H30NO+ |
| Molecular Weight | 424.60 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 1-methyl-2-[3-methyl-6-(4,4,7,7-tetradeuterio-3,3-dimethyl-5,6-dihydroinden-1-yl)dibenzofuran-4-yl]pyridin-1-ium |
| SMILES | [2H]C1([2H])CCC([2H])([2H])C2=C1C(c1cccc3c1oc1c(-c4cccc[n+]4C)c(C)ccc13)=CC2(C)C |
| InChI | InChI=1S/C30H30NO/c1-19-15-16-23-21-11-9-12-22(24-18-30(2,3)25-13-6-5-10-20(24)25)28(21)32-29(23)27(19)26-14-7-8-17-31(26)4/h7-9,11-12,14-18H,5-6,10,13H2,1-4H3/q+1/i10D2,13D2 |
| InChIKey | KOAJKMIEIGSMLF-DOWAQSPRSA-N |
| XLogP | 7.68 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.60 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|