C39H44NO+ — CID 167357386
2-[6-(4-cyclohexyl-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 167357386) has the molecular formula C39H44NO+ and a molecular weight of 542.79 g/mol. Its IUPAC name is 2-[6-(4-cyclohexyl-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-(4-cyclohexyl-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 167357386 |
| Molecular Formula | C39H44NO+ |
| Molecular Weight | 542.79 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | 2-[6-(4-cyclohexyl-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-1-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccc(C5CCCCC5)c5c4C(C)(C)CCC5(C)C)cccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C39H44NO/c1-25-18-19-31-30-16-12-15-29(36(30)41-37(31)33(25)32-17-10-11-24-40(32)6)28-21-20-27(26-13-8-7-9-14-26)34-35(28)39(4,5)23-22-38(34,2)3/h10-12,15-21,24,26H,7-9,13-14,22-23H2,1-6H3/q+1 |
| InChIKey | PDHUOQXAUUUOOW-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.79 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|