C27H27N2O+ — CID 154616240
4-cyclohexyl-2,7-dimethyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile (PubChem CID 154616240) has the molecular formula C27H27N2O+ and a molecular weight of 395.53 g/mol. Its IUPAC name is 4-cyclohexyl-2,7-dimethyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile.
| Compound Name | 4-cyclohexyl-2,7-dimethyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile |
|---|---|
| PubChem CID | 154616240 |
| Molecular Formula | C27H27N2O+ |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 4-cyclohexyl-2,7-dimethyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(C4CCCCC4)cc(C)c(C#N)c32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C27H27N2O/c1-17-12-13-20-25-22(16-28)18(2)15-21(19-9-5-4-6-10-19)27(25)30-26(20)24(17)23-11-7-8-14-29(23)3/h7-8,11-15,19H,4-6,9-10H2,1-3H3/q+1 |
| InChIKey | BZEMUVKNFSJAPM-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|