C26H25N2O+ — CID 170252802
7-cyclohexyl-2-methyl-3-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-carbonitrile (PubChem CID 170252802) has the molecular formula C26H25N2O+ and a molecular weight of 381.50 g/mol. Its IUPAC name is 7-cyclohexyl-2-methyl-3-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-carbonitrile.
| Compound Name | 7-cyclohexyl-2-methyl-3-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-carbonitrile |
|---|---|
| PubChem CID | 170252802 |
| Molecular Formula | C26H25N2O+ |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 7-cyclohexyl-2-methyl-3-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-carbonitrile |
| SMILES | Cc1cc2c(oc3cc(C4CCCCC4)ccc32)c(C#N)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C26H25N2O/c1-17-14-21-20-12-11-19(18-8-4-3-5-9-18)15-24(20)29-26(21)22(16-27)25(17)23-10-6-7-13-28(23)2/h6-7,10-15,18H,3-5,8-9H2,1-2H3/q+1 |
| InChIKey | SKDPEAOBQVDBTD-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|