C35H36NO+ — CID 166051935
2-[6-(7-cyclopentyl-2,2-dimethyl-1,3-dihydroinden-5-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166051935) has the molecular formula C35H36NO+ and a molecular weight of 486.68 g/mol. Its IUPAC name is 2-[6-(7-cyclopentyl-2,2-dimethyl-1,3-dihydroinden-5-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-(7-cyclopentyl-2,2-dimethyl-1,3-dihydroinden-5-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166051935 |
| Molecular Formula | C35H36NO+ |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | 2-[6-(7-cyclopentyl-2,2-dimethyl-1,3-dihydroinden-5-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4cc5c(c(C6CCCC6)c4)CC(C)(C)C5)cccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C35H36NO/c1-22-15-16-28-27-13-9-12-26(33(27)37-34(28)32(22)31-14-7-8-17-36(31)4)24-18-25-20-35(2,3)21-30(25)29(19-24)23-10-5-6-11-23/h7-9,12-19,23H,5-6,10-11,20-21H2,1-4H3/q+1 |
| InChIKey | XVLPSDHDIITTLN-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|