C41H50NO+ — CID 166051218
2-[6-(4-tert-butyl-5,5,6,6,7,7,8,8-octamethylnaphthalen-2-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166051218) has the molecular formula C41H50NO+ and a molecular weight of 572.86 g/mol. Its IUPAC name is 2-[6-(4-tert-butyl-5,5,6,6,7,7,8,8-octamethylnaphthalen-2-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-(4-tert-butyl-5,5,6,6,7,7,8,8-octamethylnaphthalen-2-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166051218 |
| Molecular Formula | C41H50NO+ |
| Molecular Weight | 572.86 g/mol |
| Exact Mass | 572.39 |
| IUPAC Name | 2-[6-(4-tert-butyl-5,5,6,6,7,7,8,8-octamethylnaphthalen-2-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4cc(C(C)(C)C)c5c(c4)C(C)(C)C(C)(C)C(C)(C)C5(C)C)cccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C41H50NO/c1-25-20-21-29-28-18-16-17-27(35(28)43-36(29)33(25)32-19-14-15-22-42(32)13)26-23-30(37(2,3)4)34-31(24-26)38(5,6)40(9,10)41(11,12)39(34,7)8/h14-24H,1-13H3/q+1 |
| InChIKey | AERKGKLZUHVTAH-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.86 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|