C39H44F2NO+ — CID 166051214
2-[6-(4-tert-butyl-7,7-difluoro-5,5,6,6,8,8-hexamethylnaphthalen-1-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166051214) has the molecular formula C39H44F2NO+ and a molecular weight of 580.78 g/mol. Its IUPAC name is 2-[6-(4-tert-butyl-7,7-difluoro-5,5,6,6,8,8-hexamethylnaphthalen-1-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-(4-tert-butyl-7,7-difluoro-5,5,6,6,8,8-hexamethylnaphthalen-1-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166051214 |
| Molecular Formula | C39H44F2NO+ |
| Molecular Weight | 580.78 g/mol |
| Exact Mass | 580.34 |
| IUPAC Name | 2-[6-(4-tert-butyl-7,7-difluoro-5,5,6,6,8,8-hexamethylnaphthalen-1-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccc(C(C)(C)C)c5c4C(C)(C)C(F)(F)C(C)(C)C5(C)C)cccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C39H44F2NO/c1-23-18-19-27-26-16-14-15-25(33(26)43-34(27)30(23)29-17-12-13-22-42(29)11)24-20-21-28(35(2,3)4)32-31(24)37(7,8)39(40,41)38(9,10)36(32,5)6/h12-22H,1-11H3/q+1 |
| InChIKey | GHQVGGVISQOGGL-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.78 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|