C41H45F3NO+ — CID 166051358
2-[6-[4-(1-deuteriocyclohexyl)-7,7-difluoro-5,5,6,6,8,8-hexamethylnaphthalen-1-yl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166051358) has the molecular formula C41H45F3NO+ and a molecular weight of 625.82 g/mol. Its IUPAC name is 2-[6-[4-(1-deuteriocyclohexyl)-7,7-difluoro-5,5,6,6,8,8-hexamethylnaphthalen-1-yl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-[4-(1-deuteriocyclohexyl)-7,7-difluoro-5,5,6,6,8,8-hexamethylnaphthalen-1-yl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166051358 |
| Molecular Formula | C41H45F3NO+ |
| Molecular Weight | 625.82 g/mol |
| Exact Mass | 625.35 |
| IUPAC Name | 2-[6-[4-(1-deuteriocyclohexyl)-7,7-difluoro-5,5,6,6,8,8-hexamethylnaphthalen-1-yl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [2H]C1(c2ccc(-c3c(F)ccc4c3oc3c(-c5cccc[n+]5C)c(C)ccc34)c3c2C(C)(C)C(C)(C)C(F)(F)C3(C)C)CCCCC1 |
| InChI | InChI=1S/C41H45F3NO/c1-24-17-18-27-28-21-22-30(42)33(37(28)46-36(27)32(24)31-16-12-13-23-45(31)8)29-20-19-26(25-14-10-9-11-15-25)34-35(29)39(4,5)41(43,44)40(6,7)38(34,2)3/h12-13,16-23,25H,9-11,14-15H2,1-8H3/q+1/i25D |
| InChIKey | WQVMHPZQZMJTSD-ZPJDWWTCSA-N |
| XLogP | 11.47 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.82 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|