C34H35FNO+ — CID 166051562
2-[7-fluoro-6-(1,1,2,2,3,3-hexamethylinden-4-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166051562) has the molecular formula C34H35FNO+ and a molecular weight of 492.66 g/mol. Its IUPAC name is 2-[7-fluoro-6-(1,1,2,2,3,3-hexamethylinden-4-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[7-fluoro-6-(1,1,2,2,3,3-hexamethylinden-4-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166051562 |
| Molecular Formula | C34H35FNO+ |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 2-[7-fluoro-6-(1,1,2,2,3,3-hexamethylinden-4-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4cccc5c4C(C)(C)C(C)(C)C5(C)C)c(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C34H35FNO/c1-20-15-16-21-22-17-18-25(35)28(31(22)37-30(21)27(20)26-14-9-10-19-36(26)8)23-12-11-13-24-29(23)33(4,5)34(6,7)32(24,2)3/h9-19H,1-8H3/q+1 |
| InChIKey | RLFLKLSOIBMJHP-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|