C27H21FNO2+ — CID 166051684
2-[6-(2,3-dihydro-1-benzofuran-4-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166051684) has the molecular formula C27H21FNO2+ and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-[6-(2,3-dihydro-1-benzofuran-4-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-(2,3-dihydro-1-benzofuran-4-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166051684 |
| Molecular Formula | C27H21FNO2+ |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-[6-(2,3-dihydro-1-benzofuran-4-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4cccc5c4CCO5)c(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C27H21FNO2/c1-16-9-10-19-20-11-12-21(28)25(18-6-5-8-23-17(18)13-15-30-23)27(20)31-26(19)24(16)22-7-3-4-14-29(22)2/h3-12,14H,13,15H2,1-2H3/q+1 |
| InChIKey | FDSRFQIMTWFABH-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 26.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|