C27H21FNOSe+ — CID 166050981
2-[7-fluoro-3-methyl-6-(1,1,3,3-tetradeuterio-2-benzoselenophen-4-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166050981) has the molecular formula C27H21FNOSe+ and a molecular weight of 477.45 g/mol. Its IUPAC name is 2-[7-fluoro-3-methyl-6-(1,1,3,3-tetradeuterio-2-benzoselenophen-4-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[7-fluoro-3-methyl-6-(1,1,3,3-tetradeuterio-2-benzoselenophen-4-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166050981 |
| Molecular Formula | C27H21FNOSe+ |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 2-[7-fluoro-3-methyl-6-(1,1,3,3-tetradeuterio-2-benzoselenophen-4-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [2H]C1([2H])[Se]C([2H])([2H])c2c(-c3c(F)ccc4c3oc3c(-c5cccc[n+]5C)c(C)ccc34)cccc21 |
| InChI | InChI=1S/C27H21FNOSe/c1-16-9-10-19-20-11-12-22(28)25(18-7-5-6-17-14-31-15-21(17)18)27(20)30-26(19)24(16)23-8-3-4-13-29(23)2/h3-13H,14-15H2,1-2H3/q+1/i14D2,15D2 |
| InChIKey | MNPYEWNHWDNLLP-QZPARXMSSA-N |
| XLogP | 5.91 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|