C28H23FNO2+ — CID 166051333
2-[6-(4,4-dideuterio-2,3-dihydrochromen-5-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166051333) has the molecular formula C28H23FNO2+ and a molecular weight of 426.51 g/mol. Its IUPAC name is 2-[6-(4,4-dideuterio-2,3-dihydrochromen-5-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-(4,4-dideuterio-2,3-dihydrochromen-5-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166051333 |
| Molecular Formula | C28H23FNO2+ |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-[6-(4,4-dideuterio-2,3-dihydrochromen-5-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [2H]C1([2H])CCOc2cccc(-c3c(F)ccc4c3oc3c(-c5cccc[n+]5C)c(C)ccc34)c21 |
| InChI | InChI=1S/C28H23FNO2/c1-17-11-12-20-21-13-14-22(29)26(19-7-5-10-24-18(19)8-6-16-31-24)28(21)32-27(20)25(17)23-9-3-4-15-30(23)2/h3-5,7,9-15H,6,8,16H2,1-2H3/q+1/i8D2 |
| InChIKey | YOFUNSJYPJKJKG-MGVXTIMCSA-N |
| XLogP | 6.52 |
| TPSA | 26.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|