C35H37FNO+ — CID 166051267
2-[7-fluoro-6-(1,1,2,2,3,3,7-heptamethylinden-4-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166051267) has the molecular formula C35H37FNO+ and a molecular weight of 506.69 g/mol. Its IUPAC name is 2-[7-fluoro-6-(1,1,2,2,3,3,7-heptamethylinden-4-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[7-fluoro-6-(1,1,2,2,3,3,7-heptamethylinden-4-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166051267 |
| Molecular Formula | C35H37FNO+ |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 2-[7-fluoro-6-(1,1,2,2,3,3,7-heptamethylinden-4-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc(-c2c(F)ccc3c2oc2c(-c4cccc[n+]4C)c(C)ccc23)c2c1C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C35H37FNO/c1-20-13-15-22-23-17-18-25(36)28(32(23)38-31(22)27(20)26-12-10-11-19-37(26)9)24-16-14-21(2)29-30(24)34(5,6)35(7,8)33(29,3)4/h10-19H,1-9H3/q+1 |
| InChIKey | KDPCKTPIZYWYRL-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|