C42H49FNO+ — CID 166051869
2-[6-[4-(1-deuteriocyclopentyl)-5,5,6,6,7,7,8,8-octamethylnaphthalen-1-yl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166051869) has the molecular formula C42H49FNO+ and a molecular weight of 603.86 g/mol. Its IUPAC name is 2-[6-[4-(1-deuteriocyclopentyl)-5,5,6,6,7,7,8,8-octamethylnaphthalen-1-yl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-[4-(1-deuteriocyclopentyl)-5,5,6,6,7,7,8,8-octamethylnaphthalen-1-yl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166051869 |
| Molecular Formula | C42H49FNO+ |
| Molecular Weight | 603.86 g/mol |
| Exact Mass | 603.39 |
| IUPAC Name | 2-[6-[4-(1-deuteriocyclopentyl)-5,5,6,6,7,7,8,8-octamethylnaphthalen-1-yl]-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [2H]C1(c2ccc(-c3c(F)ccc4c3oc3c(-c5cccc[n+]5C)c(C)ccc34)c3c2C(C)(C)C(C)(C)C(C)(C)C3(C)C)CCCC1 |
| InChI | InChI=1S/C42H49FNO/c1-25-18-19-28-29-22-23-31(43)34(38(29)45-37(28)33(25)32-17-13-14-24-44(32)10)30-21-20-27(26-15-11-12-16-26)35-36(30)40(4,5)42(8,9)41(6,7)39(35,2)3/h13-14,17-24,26H,11-12,15-16H2,1-10H3/q+1/i26D |
| InChIKey | MCTYVSZOXUFCRZ-HKAOEGRMSA-N |
| XLogP | 11.47 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.86 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|