C28H29FNO+ — CID 166051779
2-[6-(5-deuterio-1,2,3,3a,4,6,7,7a-octahydroinden-5-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166051779) has the molecular formula C28H29FNO+ and a molecular weight of 415.55 g/mol. Its IUPAC name is 2-[6-(5-deuterio-1,2,3,3a,4,6,7,7a-octahydroinden-5-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-(5-deuterio-1,2,3,3a,4,6,7,7a-octahydroinden-5-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166051779 |
| Molecular Formula | C28H29FNO+ |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 2-[6-(5-deuterio-1,2,3,3a,4,6,7,7a-octahydroinden-5-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [2H]C1(c2c(F)ccc3c2oc2c(-c4cccc[n+]4C)c(C)ccc23)CCC2CCCC2C1 |
| InChI | InChI=1S/C28H29FNO/c1-17-9-12-21-22-13-14-23(29)26(20-11-10-18-6-5-7-19(18)16-20)28(22)31-27(21)25(17)24-8-3-4-15-30(24)2/h3-4,8-9,12-15,18-20H,5-7,10-11,16H2,1-2H3/q+1/i20D |
| InChIKey | RYRPQIDOHMZFAA-YVHRXSIGSA-N |
| XLogP | 7.21 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|