C34H33FNO+ — CID 166051640
2-[6-(2-cyclohexyl-2,3-dihydro-1H-inden-5-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166051640) has the molecular formula C34H33FNO+ and a molecular weight of 490.64 g/mol. Its IUPAC name is 2-[6-(2-cyclohexyl-2,3-dihydro-1H-inden-5-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-(2-cyclohexyl-2,3-dihydro-1H-inden-5-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166051640 |
| Molecular Formula | C34H33FNO+ |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 2-[6-(2-cyclohexyl-2,3-dihydro-1H-inden-5-yl)-7-fluoro-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccc5c(c4)CC(C4CCCCC4)C5)c(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C34H33FNO/c1-21-11-14-27-28-15-16-29(35)32(34(28)37-33(27)31(21)30-10-6-7-17-36(30)2)24-13-12-23-18-25(20-26(23)19-24)22-8-4-3-5-9-22/h6-7,10-17,19,22,25H,3-5,8-9,18,20H2,1-2H3/q+1 |
| InChIKey | KOMWGCVRIRDVLA-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|