C35H36NO+ — CID 166051706
2-[6-(6-cyclohexyl-5,5,8,8-tetradeuterio-6,7-dihydronaphthalen-2-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166051706) has the molecular formula C35H36NO+ and a molecular weight of 490.70 g/mol. Its IUPAC name is 2-[6-(6-cyclohexyl-5,5,8,8-tetradeuterio-6,7-dihydronaphthalen-2-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[6-(6-cyclohexyl-5,5,8,8-tetradeuterio-6,7-dihydronaphthalen-2-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166051706 |
| Molecular Formula | C35H36NO+ |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | 2-[6-(6-cyclohexyl-5,5,8,8-tetradeuterio-6,7-dihydronaphthalen-2-yl)-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [2H]C1([2H])CC(C2CCCCC2)C([2H])([2H])c2ccc(-c3cccc4c3oc3c(-c5cccc[n+]5C)c(C)ccc34)cc21 |
| InChI | InChI=1S/C35H36NO/c1-23-14-19-31-30-12-8-11-29(34(30)37-35(31)33(23)32-13-6-7-20-36(32)2)28-18-17-26-21-25(15-16-27(26)22-28)24-9-4-3-5-10-24/h6-8,11-14,17-20,22,24-25H,3-5,9-10,15-16,21H2,1-2H3/q+1/i16D2,21D2 |
| InChIKey | FGONZNZGMWKFDY-MIULYYKYSA-N |
| XLogP | 8.74 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|